C31H39NO7 — CID 57335328
[(1R,2S,3R,5R,6R,8S,10E,12R,13S,16R,17S)-17-benzyl-6-ethyl-6,13-dihydroxy-8,14,15-trimethyl-7,19-dioxo-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadeca-10,14-dien-2-yl] acetate (PubChem CID 57335328) has the molecular formula C31H39NO7 and a molecular weight of 537.65 g/mol. Its IUPAC name is [(1R,2S,3R,5R,6R,8S,10E,12R,13S,16R,17S)-17-benzyl-6-ethyl-6,13-dihydroxy-8,14,15-trimethyl-7,19-dioxo-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadeca-10,14-dien-2-yl] acetate.
| Compound Name | [(1R,2S,3R,5R,6R,8S,10E,12R,13S,16R,17S)-17-benzyl-6-ethyl-6,13-dihydroxy-8,14,15-trimethyl-7,19-dioxo-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadeca-10,14-dien-2-yl] acetate |
|---|---|
| PubChem CID | 57335328 |
| Molecular Formula | C31H39NO7 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | [(1R,2S,3R,5R,6R,8S,10E,12R,13S,16R,17S)-17-benzyl-6-ethyl-6,13-dihydroxy-8,14,15-trimethyl-7,19-dioxo-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadeca-10,14-dien-2-yl] acetate |
| SMILES | CC[C@]1(O)C(=O)[C@@H](C)C/C=C/[C@H]2[C@H](O)C(C)=C(C)[C@H]3[C@H](Cc4ccccc4)NC(=O)[C@@]23[C@H](OC(C)=O)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C31H39NO7/c1-6-30(37)26(35)16(2)11-10-14-21-24(34)18(4)17(3)23-22(15-20-12-8-7-9-13-20)32-29(36)31(21,23)28(38-19(5)33)25-27(30)39-25/h7-10,12-14,16,21-25,27-28,34,37H,6,11,15H2,1-5H3,(H,32,36)/b14-10+/t16-,21-,22-,23-,24+,25-,27+,28+,30-,31-/m0/s1 |
| InChIKey | VEXZEQWVUKCHNC-UGWQHBBHSA-N |
| XLogP | 2.66 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|