C14H18O3 — CID 57335616
(1aS,3aS,7bR)-1a-acetyl-3a,7-dimethyl-3,4,5,7b-tetrahydro-2H-naphtho[1,2-b]oxiren-6-one (PubChem CID 57335616) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (1aS,3aS,7bR)-1a-acetyl-3a,7-dimethyl-3,4,5,7b-tetrahydro-2H-naphtho[1,2-b]oxiren-6-one.
| Compound Name | (1aS,3aS,7bR)-1a-acetyl-3a,7-dimethyl-3,4,5,7b-tetrahydro-2H-naphtho[1,2-b]oxiren-6-one |
|---|---|
| PubChem CID | 57335616 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1aS,3aS,7bR)-1a-acetyl-3a,7-dimethyl-3,4,5,7b-tetrahydro-2H-naphtho[1,2-b]oxiren-6-one |
| SMILES | CC(=O)[C@]12CC[C@@]3(C)CCC(=O)C(C)=C3[C@H]1O2 |
| InChI | InChI=1S/C14H18O3/c1-8-10(16)4-5-13(3)6-7-14(9(2)15)12(17-14)11(8)13/h12H,4-7H2,1-3H3/t12-,13-,14-/m1/s1 |
| InChIKey | WEPFDGKIDPCING-MGPQQGTHSA-N |
| XLogP | 2.19 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|