C21H13N4NaO3S — CID 57336053
sodium 5-[3-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]benzo[g][1,5]benzodiazepin-1-ide-2,4-dione (PubChem CID 57336053) has the molecular formula C21H13N4NaO3S and a molecular weight of 424.42 g/mol. Its IUPAC name is sodium 5-[3-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]benzo[g][1,5]benzodiazepin-1-ide-2,4-dione.
| Compound Name | sodium 5-[3-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]benzo[g][1,5]benzodiazepin-1-ide-2,4-dione |
|---|---|
| PubChem CID | 57336053 |
| Molecular Formula | C21H13N4NaO3S |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | sodium 5-[3-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]benzo[g][1,5]benzodiazepin-1-ide-2,4-dione |
| SMILES | O=C1CC(=O)N(c2cccc(-c3nc(=S)o[nH]3)c2)c2ccc3ccccc3c2[N-]1.[Na+] |
| InChI | InChI=1S/C21H14N4O3S.Na/c26-17-11-18(27)25(14-6-3-5-13(10-14)20-23-21(29)28-24-20)16-9-8-12-4-1-2-7-15(12)19(16)22-17;/h1-10H,11H2,(H2,22,23,24,26,29);/q;+1/p-1 |
| InChIKey | MIBCQKIVVIBTLQ-UHFFFAOYSA-M |
| XLogP | 2.16 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|