C14H10N4O2S — CID 57336363
6-(benzylamino)-2,4-dioxo-1H-thieno[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 57336363) has the molecular formula C14H10N4O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 6-(benzylamino)-2,4-dioxo-1H-thieno[3,2-d]pyrimidine-7-carbonitrile.
| Compound Name | 6-(benzylamino)-2,4-dioxo-1H-thieno[3,2-d]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 57336363 |
| Molecular Formula | C14H10N4O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 6-(benzylamino)-2,4-dioxo-1H-thieno[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | N#Cc1c(NCc2ccccc2)sc2c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C14H10N4O2S/c15-6-9-10-11(12(19)18-14(20)17-10)21-13(9)16-7-8-4-2-1-3-5-8/h1-5,16H,7H2,(H2,17,18,19,20) |
| InChIKey | QNPCGDIIBLZRNT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |