About N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide
N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 57336472) has the molecular formula C26H35N3O4
and a molecular weight of 453.58 g/mol. Its IUPAC name is N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide |
| PubChem CID | 57336472 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | CN(C)C(=O)COc1ccc(-c2cc(C(=O)N(C3CCCCC3)C3CCCCC3)no2)cc1 |
| InChI | InChI=1S/C26H35N3O4/c1-28(2)25(30)18-32-22-15-13-19(14-16-22)24-17-23(27-33-24)26(31)29(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h13-17,20-21H,3-12,18H2,1-2H3 |
| InChIKey | ZLZGGOXSTWEWLY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide?
The IUPAC name of N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide (CID 57336472) is N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide?
The canonical SMILES for N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide is CN(C)C(=O)COc1ccc(-c2cc(C(=O)N(C3CCCCC3)C3CCCCC3)no2)cc1.
What is the InChIKey of N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide?
The InChIKey is ZLZGGOXSTWEWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35N3O4/c1-28(2)25(30)18-32-22-15-13-19(14-16-22)24-17-23(27-33-24)26(31)29(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h13-17,20-21H,3-12,18H2,1-2H3.
What are the key properties of N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide?
N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide has a molecular weight of 453.58 g/mol, XLogP of 4.92, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dicyclohexyl-5-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 57336472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).