C22H20N2O4S — CID 57336496
(4S)-5-amino-5-oxo-4-[[4-(4-phenylthiophen-2-yl)benzoyl]amino]pentanoic acid (PubChem CID 57336496) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is (4S)-5-amino-5-oxo-4-[[4-(4-phenylthiophen-2-yl)benzoyl]amino]pentanoic acid.
| Compound Name | (4S)-5-amino-5-oxo-4-[[4-(4-phenylthiophen-2-yl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 57336496 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | (4S)-5-amino-5-oxo-4-[[4-(4-phenylthiophen-2-yl)benzoyl]amino]pentanoic acid |
| SMILES | NC(=O)[C@H](CCC(=O)O)NC(=O)c1ccc(-c2cc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C22H20N2O4S/c23-21(27)18(10-11-20(25)26)24-22(28)16-8-6-15(7-9-16)19-12-17(13-29-19)14-4-2-1-3-5-14/h1-9,12-13,18H,10-11H2,(H2,23,27)(H,24,28)(H,25,26)/t18-/m0/s1 |
| InChIKey | ADDJDJQFPKUMAF-SFHVURJKSA-N |
| XLogP | 3.53 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |