C20H12F12N2O3 — CID 57336561
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-hydroxy-N'-(4-phenylphenyl)octanediamide (PubChem CID 57336561) has the molecular formula C20H12F12N2O3 and a molecular weight of 556.30 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-hydroxy-N'-(4-phenylphenyl)octanediamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-hydroxy-N'-(4-phenylphenyl)octanediamide |
|---|---|
| PubChem CID | 57336561 |
| Molecular Formula | C20H12F12N2O3 |
| Molecular Weight | 556.30 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-hydroxy-N'-(4-phenylphenyl)octanediamide |
| SMILES | O=C(NO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H12F12N2O3/c21-15(22,13(35)33-12-8-6-11(7-9-12)10-4-2-1-3-5-10)17(25,26)19(29,30)20(31,32)18(27,28)16(23,24)14(36)34-37/h1-9,37H,(H,33,35)(H,34,36) |
| InChIKey | OUDVCJKXBXYAJV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.30 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|