C24H12F12N2O3 — CID 57336564
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-hydroxy-N'-pyren-1-yloctanediamide (PubChem CID 57336564) has the molecular formula C24H12F12N2O3 and a molecular weight of 604.35 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-hydroxy-N'-pyren-1-yloctanediamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-hydroxy-N'-pyren-1-yloctanediamide |
|---|---|
| PubChem CID | 57336564 |
| Molecular Formula | C24H12F12N2O3 |
| Molecular Weight | 604.35 g/mol |
| Exact Mass | 604.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-hydroxy-N'-pyren-1-yloctanediamide |
| SMILES | O=C(NO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)Nc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C24H12F12N2O3/c25-19(26,21(29,30)23(33,34)24(35,36)22(31,32)20(27,28)18(40)38-41)17(39)37-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,41H,(H,37,39)(H,38,40) |
| InChIKey | GESAHKRRNZDSAD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.35 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|