About spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione
spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione (PubChem CID 57336667) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione.
Molecular Properties
| Compound Name | spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione |
| PubChem CID | 57336667 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione |
| SMILES | O=C1NC(=O)C2(CC2)c2ccccc21 |
| InChI | InChI=1S/C11H9NO2/c13-9-7-3-1-2-4-8(7)11(5-6-11)10(14)12-9/h1-4H,5-6H2,(H,12,13,14) |
| InChIKey | GLVMLLRAWVMDQC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione?
The IUPAC name of spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione (CID 57336667) is spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione.
What is the SMILES notation for spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione?
The canonical SMILES for spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione is O=C1NC(=O)C2(CC2)c2ccccc21.
What is the InChIKey of spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione?
The InChIKey is GLVMLLRAWVMDQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-9-7-3-1-2-4-8(7)11(5-6-11)10(14)12-9/h1-4H,5-6H2,(H,12,13,14).
What are the key properties of spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione?
spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione has a molecular weight of 187.20 g/mol, XLogP of 0.99, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione is sourced from PubChem (CID 57336667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).