C16H20O4 — CID 57337092
(3S,6R)-7-benzyl-1,3,6-trimethyl-2,4,5,10-tetraoxatricyclo[4.3.1.03,7]decane (PubChem CID 57337092) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3S,6R)-7-benzyl-1,3,6-trimethyl-2,4,5,10-tetraoxatricyclo[4.3.1.03,7]decane.
| Compound Name | (3S,6R)-7-benzyl-1,3,6-trimethyl-2,4,5,10-tetraoxatricyclo[4.3.1.03,7]decane |
|---|---|
| PubChem CID | 57337092 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3S,6R)-7-benzyl-1,3,6-trimethyl-2,4,5,10-tetraoxatricyclo[4.3.1.03,7]decane |
| SMILES | CC12CCC3(Cc4ccccc4)[C@@](C)(OO[C@]3(C)O1)O2 |
| InChI | InChI=1S/C16H20O4/c1-13-9-10-16(11-12-7-5-4-6-8-12)14(2,17-13)19-20-15(16,3)18-13/h4-8H,9-11H2,1-3H3/t13?,14-,15+,16? |
| InChIKey | QEZPIJHDSXXMIS-IRHLINNNSA-N |
| XLogP | 3.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|