C16H25N3O3 — CID 57337321
(2Z,4E)-6-methyl-N-[3-oxo-3-[[(3S)-2-oxopiperidin-3-yl]amino]propyl]hepta-2,4-dienamide (PubChem CID 57337321) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2Z,4E)-6-methyl-N-[3-oxo-3-[[(3S)-2-oxopiperidin-3-yl]amino]propyl]hepta-2,4-dienamide.
| Compound Name | (2Z,4E)-6-methyl-N-[3-oxo-3-[[(3S)-2-oxopiperidin-3-yl]amino]propyl]hepta-2,4-dienamide |
|---|---|
| PubChem CID | 57337321 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (2Z,4E)-6-methyl-N-[3-oxo-3-[[(3S)-2-oxopiperidin-3-yl]amino]propyl]hepta-2,4-dienamide |
| SMILES | CC(C)/C=C/C=C\C(=O)NCCC(=O)N[C@H]1CCCNC1=O |
| InChI | InChI=1S/C16H25N3O3/c1-12(2)6-3-4-8-14(20)17-11-9-15(21)19-13-7-5-10-18-16(13)22/h3-4,6,8,12-13H,5,7,9-11H2,1-2H3,(H,17,20)(H,18,22)(H,19,21)/b6-3+,8-4-/t13-/m0/s1 |
| InChIKey | BOQTVXNEPKMGCB-UKMVMEMCSA-N |
| XLogP | 0.66 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|