C7H5F7N2OS — CID 57337582
[2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-thiazol-4-yl]methanol (PubChem CID 57337582) has the molecular formula C7H5F7N2OS and a molecular weight of 298.18 g/mol. Its IUPAC name is [2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 57337582 |
| Molecular Formula | C7H5F7N2OS |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | [2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-thiazol-4-yl]methanol |
| SMILES | Nc1nc(CO)c(C(F)(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H5F7N2OS/c8-5(6(9,10)11,7(12,13)14)3-2(1-17)16-4(15)18-3/h17H,1H2,(H2,15,16) |
| InChIKey | QOBFPILHEPRZBB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |