About CID 57337752
CID 57337752 (PubChem CID 57337752) has the molecular formula C23H40N2O10S4
and a molecular weight of 632.85 g/mol.
Molecular Properties
| Compound Name | CID 57337752 |
| PubChem CID | 57337752 |
| Molecular Formula | C23H40N2O10S4 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | — |
| SMILES | CC1(C)CC2(CC(C)(C)N1[O])S(=O)(=O)CC1(CS2(=O)=O)CS(=O)(=O)C2(CC(C)(C)N([O])C(C)(C)C2)S(=O)(=O)C1 |
| InChI | InChI=1S/C23H40N2O10S4/c1-17(2)9-22(10-18(3,4)24(17)26)36(28,29)13-21(14-37(22,30)31)15-38(32,33)23(39(34,35)16-21)11-19(5,6)25(27)20(7,8)12-23/h9-16H2,1-8H3 |
| InChIKey | CXZSCBFVWLCBRF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 182.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze CID 57337752 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57337752?
The IUPAC name of CID 57337752 (CID 57337752) is not available.
What is the SMILES notation for CID 57337752?
The canonical SMILES for CID 57337752 is CC1(C)CC2(CC(C)(C)N1[O])S(=O)(=O)CC1(CS2(=O)=O)CS(=O)(=O)C2(CC(C)(C)N([O])C(C)(C)C2)S(=O)(=O)C1.
What is the InChIKey of CID 57337752?
The InChIKey is CXZSCBFVWLCBRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40N2O10S4/c1-17(2)9-22(10-18(3,4)24(17)26)36(28,29)13-21(14-37(22,30)31)15-38(32,33)23(39(34,35)16-21)11-19(5,6)25(27)20(7,8)12-23/h9-16H2,1-8H3.
What are the key properties of CID 57337752?
CID 57337752 has a molecular weight of 632.85 g/mol, XLogP of 1.05, 0 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57337752 is sourced from PubChem (CID 57337752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).