C29H20N4O5S — CID 57337942
2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)-6-nitroquinoline (PubChem CID 57337942) has the molecular formula C29H20N4O5S and a molecular weight of 536.57 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)-6-nitroquinoline.
| Compound Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)-6-nitroquinoline |
|---|---|
| PubChem CID | 57337942 |
| Molecular Formula | C29H20N4O5S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)-6-nitroquinoline |
| SMILES | COc1ccccc1-c1cc(-c2cn(S(=O)(=O)c3ccccc3)c3ncccc23)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C29H20N4O5S/c1-38-28-12-6-5-10-21(28)23-17-27(31-26-14-13-19(33(34)35)16-24(23)26)25-18-32(29-22(25)11-7-15-30-29)39(36,37)20-8-3-2-4-9-20/h2-18H,1H3 |
| InChIKey | JUONWKVTEQECTO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 117.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|