C31H68O7Si4 — CID 57338126
methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3S,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]acetate (PubChem CID 57338126) has the molecular formula C31H68O7Si4 and a molecular weight of 665.22 g/mol. Its IUPAC name is methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3S,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]acetate.
| Compound Name | methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3S,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 57338126 |
| Molecular Formula | C31H68O7Si4 |
| Molecular Weight | 665.22 g/mol |
| Exact Mass | 664.40 |
| IUPAC Name | methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3S,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]acetate |
| SMILES | COC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H68O7Si4/c1-28(2,3)39(14,15)35-23-22(24(26(32)33-13)36-40(16,17)29(4,5)6)34-27(38-42(20,21)31(10,11)12)25(23)37-41(18,19)30(7,8)9/h22-25,27H,1-21H3/t22-,23+,24+,25-,27+/m1/s1 |
| InChIKey | NTHNPYKQHNUUQD-VJIOPBFVSA-N |
| XLogP | 9.08 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.22 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|