C19H34O3 — CID 57338517
ethyl (2R,3S,5S,6S)-2-ethyl-6-hexyl-5-prop-1-en-2-yloxane-3-carboxylate (PubChem CID 57338517) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is ethyl (2R,3S,5S,6S)-2-ethyl-6-hexyl-5-prop-1-en-2-yloxane-3-carboxylate.
| Compound Name | ethyl (2R,3S,5S,6S)-2-ethyl-6-hexyl-5-prop-1-en-2-yloxane-3-carboxylate |
|---|---|
| PubChem CID | 57338517 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | ethyl (2R,3S,5S,6S)-2-ethyl-6-hexyl-5-prop-1-en-2-yloxane-3-carboxylate |
| SMILES | C=C(C)[C@@H]1C[C@H](C(=O)OCC)[C@@H](CC)O[C@H]1CCCCCC |
| InChI | InChI=1S/C19H34O3/c1-6-9-10-11-12-18-15(14(4)5)13-16(17(7-2)22-18)19(20)21-8-3/h15-18H,4,6-13H2,1-3,5H3/t15-,16-,17+,18-/m0/s1 |
| InChIKey | OKZSFEVBQNGSAV-FJIDUMEYSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|