C17H30O3 — CID 57338518
ethyl (2R,3S,5S,6S)-2-ethyl-6-(2-methylpropyl)-5-prop-1-en-2-yloxane-3-carboxylate (PubChem CID 57338518) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is ethyl (2R,3S,5S,6S)-2-ethyl-6-(2-methylpropyl)-5-prop-1-en-2-yloxane-3-carboxylate.
| Compound Name | ethyl (2R,3S,5S,6S)-2-ethyl-6-(2-methylpropyl)-5-prop-1-en-2-yloxane-3-carboxylate |
|---|---|
| PubChem CID | 57338518 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | ethyl (2R,3S,5S,6S)-2-ethyl-6-(2-methylpropyl)-5-prop-1-en-2-yloxane-3-carboxylate |
| SMILES | C=C(C)[C@@H]1C[C@H](C(=O)OCC)[C@@H](CC)O[C@H]1CC(C)C |
| InChI | InChI=1S/C17H30O3/c1-7-15-14(17(18)19-8-2)10-13(12(5)6)16(20-15)9-11(3)4/h11,13-16H,5,7-10H2,1-4,6H3/t13-,14-,15+,16-/m0/s1 |
| InChIKey | FCGDNOWDBUXSST-JONQDZQNSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|