C32H31N3O4 — CID 57338713
9-[[3-[4-(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-20,20-dimethyl-22-oxa-9,21-diazapentacyclo[14.6.0.02,7.010,15.017,21]docosa-1(16),2,4,6,10,12,14-heptaen-8-one (PubChem CID 57338713) has the molecular formula C32H31N3O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is 9-[[3-[4-(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-20,20-dimethyl-22-oxa-9,21-diazapentacyclo[14.6.0.02,7.010,15.017,21]docosa-1(16),2,4,6,10,12,14-heptaen-8-one.
| Compound Name | 9-[[3-[4-(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-20,20-dimethyl-22-oxa-9,21-diazapentacyclo[14.6.0.02,7.010,15.017,21]docosa-1(16),2,4,6,10,12,14-heptaen-8-one |
|---|---|
| PubChem CID | 57338713 |
| Molecular Formula | C32H31N3O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 9-[[3-[4-(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-20,20-dimethyl-22-oxa-9,21-diazapentacyclo[14.6.0.02,7.010,15.017,21]docosa-1(16),2,4,6,10,12,14-heptaen-8-one |
| SMILES | CC1(C)CCC2C3=C(ON21)c1ccccc1C(=O)N(CC1CC(c2ccc(CO)cc2)=NO1)c1ccccc13 |
| InChI | InChI=1S/C32H31N3O4/c1-32(2)16-15-28-29-25-9-5-6-10-27(25)34(31(37)24-8-4-3-7-23(24)30(29)39-35(28)32)18-22-17-26(33-38-22)21-13-11-20(19-36)12-14-21/h3-14,22,28,36H,15-19H2,1-2H3 |
| InChIKey | IRINOWYBBKZUPX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|