C12H23NO6 — CID 57338756
(3R,4S,5S,6R)-3,4,5,6-tetrahydroxy-1-(6-hydroxyhexyl)azepan-2-one (PubChem CID 57338756) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3,4,5,6-tetrahydroxy-1-(6-hydroxyhexyl)azepan-2-one.
| Compound Name | (3R,4S,5S,6R)-3,4,5,6-tetrahydroxy-1-(6-hydroxyhexyl)azepan-2-one |
|---|---|
| PubChem CID | 57338756 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (3R,4S,5S,6R)-3,4,5,6-tetrahydroxy-1-(6-hydroxyhexyl)azepan-2-one |
| SMILES | O=C1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CN1CCCCCCO |
| InChI | InChI=1S/C12H23NO6/c14-6-4-2-1-3-5-13-7-8(15)9(16)10(17)11(18)12(13)19/h8-11,14-18H,1-7H2/t8-,9+,10+,11-/m1/s1 |
| InChIKey | WNYAVKUMBOAUQY-VPOLOUISSA-N |
| XLogP | -2.18 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|