About CID 57339069
CID 57339069 (PubChem CID 57339069) has the molecular formula C25H26N9O
and a molecular weight of 468.55 g/mol.
Molecular Properties
| Compound Name | CID 57339069 |
| PubChem CID | 57339069 |
| Molecular Formula | C25H26N9O |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | — |
| SMILES | CC(C)N1[N]C(c2cccc(-c3cc(-n4cccn4)nc(-n4cccn4)c3)c2)=NN(C(C)C)C1=O |
| InChI | InChI=1S/C25H26N9O/c1-17(2)33-25(35)34(18(3)4)30-24(29-33)20-9-5-8-19(14-20)21-15-22(31-12-6-10-26-31)28-23(16-21)32-13-7-11-27-32/h5-18H,1-4H3 |
| InChIKey | PPBBHAFYKWLDON-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 98.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 57339069 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57339069?
The IUPAC name of CID 57339069 (CID 57339069) is not available.
What is the SMILES notation for CID 57339069?
The canonical SMILES for CID 57339069 is CC(C)N1[N]C(c2cccc(-c3cc(-n4cccn4)nc(-n4cccn4)c3)c2)=NN(C(C)C)C1=O.
What is the InChIKey of CID 57339069?
The InChIKey is PPBBHAFYKWLDON-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N9O/c1-17(2)33-25(35)34(18(3)4)30-24(29-33)20-9-5-8-19(14-20)21-15-22(31-12-6-10-26-31)28-23(16-21)32-13-7-11-27-32/h5-18H,1-4H3.
What are the key properties of CID 57339069?
CID 57339069 has a molecular weight of 468.55 g/mol, XLogP of 3.86, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57339069 is sourced from PubChem (CID 57339069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).