About 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate
2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate (PubChem CID 57339248) has the molecular formula C10H13O3-
and a molecular weight of 181.21 g/mol. Its IUPAC name is 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate.
Molecular Properties
| Compound Name | 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate |
| PubChem CID | 57339248 |
| Molecular Formula | C10H13O3- |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate |
| SMILES | CC1=CC(=O)[C@H](CC(=O)[O-])C1(C)C |
| InChI | InChI=1S/C10H14O3/c1-6-4-8(11)7(5-9(12)13)10(6,2)3/h4,7H,5H2,1-3H3,(H,12,13)/p-1/t7-/m0/s1 |
| InChIKey | UJJNLVMCZZZXFW-ZETCQYMHSA-M |
| XLogP | 0.30 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate?
The IUPAC name of 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate (CID 57339248) is 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate.
What is the SMILES notation for 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate?
The canonical SMILES for 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate is CC1=CC(=O)[C@H](CC(=O)[O-])C1(C)C.
What is the InChIKey of 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate?
The InChIKey is UJJNLVMCZZZXFW-ZETCQYMHSA-M. The full InChI is InChI=1S/C10H14O3/c1-6-4-8(11)7(5-9(12)13)10(6,2)3/h4,7H,5H2,1-3H3,(H,12,13)/p-1/t7-/m0/s1.
What are the key properties of 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate?
2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate has a molecular weight of 181.21 g/mol, XLogP of 0.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl]acetate is sourced from PubChem (CID 57339248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).