C6H14NO4+ — CID 57339265
[(1S,2R,3S,4S,5R)-2,3,4,5-tetrahydroxycyclohexyl]azanium (PubChem CID 57339265) has the molecular formula C6H14NO4+ and a molecular weight of 164.18 g/mol. Its IUPAC name is [(1S,2R,3S,4S,5R)-2,3,4,5-tetrahydroxycyclohexyl]azanium.
| Compound Name | [(1S,2R,3S,4S,5R)-2,3,4,5-tetrahydroxycyclohexyl]azanium |
|---|---|
| PubChem CID | 57339265 |
| Molecular Formula | C6H14NO4+ |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | [(1S,2R,3S,4S,5R)-2,3,4,5-tetrahydroxycyclohexyl]azanium |
| SMILES | [NH3+][C@H]1C[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO4/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,8-11H,1,7H2/p+1/t2-,3+,4+,5-,6-/m0/s1 |
| InChIKey | QXQNRSUOYNMXDL-KGJVWPDLSA-O |
| XLogP | -3.56 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |