C30H35NO4 — CID 57339605
(4S)-4-(6-phenylhexanoylamino)-5-(4-phenylmethoxyphenyl)pentanoic acid (PubChem CID 57339605) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is (4S)-4-(6-phenylhexanoylamino)-5-(4-phenylmethoxyphenyl)pentanoic acid.
| Compound Name | (4S)-4-(6-phenylhexanoylamino)-5-(4-phenylmethoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 57339605 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | (4S)-4-(6-phenylhexanoylamino)-5-(4-phenylmethoxyphenyl)pentanoic acid |
| SMILES | O=C(O)CC[C@@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)CCCCCc1ccccc1 |
| InChI | InChI=1S/C30H35NO4/c32-29(15-9-3-6-12-24-10-4-1-5-11-24)31-27(18-21-30(33)34)22-25-16-19-28(20-17-25)35-23-26-13-7-2-8-14-26/h1-2,4-5,7-8,10-11,13-14,16-17,19-20,27H,3,6,9,12,15,18,21-23H2,(H,31,32)(H,33,34)/t27-/m0/s1 |
| InChIKey | DPPRIMRRTSWLEO-MHZLTWQESA-N |
| XLogP | 5.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|