C33H40N2O5 — CID 57339608
(4S)-4-[7-(2-acetamidophenyl)heptanoylamino]-5-(4-phenylmethoxyphenyl)pentanoic acid (PubChem CID 57339608) has the molecular formula C33H40N2O5 and a molecular weight of 544.69 g/mol. Its IUPAC name is (4S)-4-[7-(2-acetamidophenyl)heptanoylamino]-5-(4-phenylmethoxyphenyl)pentanoic acid.
| Compound Name | (4S)-4-[7-(2-acetamidophenyl)heptanoylamino]-5-(4-phenylmethoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 57339608 |
| Molecular Formula | C33H40N2O5 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | (4S)-4-[7-(2-acetamidophenyl)heptanoylamino]-5-(4-phenylmethoxyphenyl)pentanoic acid |
| SMILES | CC(=O)Nc1ccccc1CCCCCCC(=O)N[C@@H](CCC(=O)O)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H40N2O5/c1-25(36)34-31-15-10-9-14-28(31)13-7-2-3-8-16-32(37)35-29(19-22-33(38)39)23-26-17-20-30(21-18-26)40-24-27-11-5-4-6-12-27/h4-6,9-12,14-15,17-18,20-21,29H,2-3,7-8,13,16,19,22-24H2,1H3,(H,34,36)(H,35,37)(H,38,39)/t29-/m0/s1 |
| InChIKey | BOKKJXMQQMLRCQ-LJAQVGFWSA-N |
| XLogP | 6.31 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|