C29H34N2O4 — CID 57339611
(4S)-4-(7-phenylheptanoylamino)-5-(4-pyridin-2-yloxyphenyl)pentanoic acid (PubChem CID 57339611) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is (4S)-4-(7-phenylheptanoylamino)-5-(4-pyridin-2-yloxyphenyl)pentanoic acid.
| Compound Name | (4S)-4-(7-phenylheptanoylamino)-5-(4-pyridin-2-yloxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 57339611 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (4S)-4-(7-phenylheptanoylamino)-5-(4-pyridin-2-yloxyphenyl)pentanoic acid |
| SMILES | O=C(O)CC[C@@H](Cc1ccc(Oc2ccccn2)cc1)NC(=O)CCCCCCc1ccccc1 |
| InChI | InChI=1S/C29H34N2O4/c32-27(13-7-2-1-4-10-23-11-5-3-6-12-23)31-25(17-20-29(33)34)22-24-15-18-26(19-16-24)35-28-14-8-9-21-30-28/h3,5-6,8-9,11-12,14-16,18-19,21,25H,1-2,4,7,10,13,17,20,22H2,(H,31,32)(H,33,34)/t25-/m0/s1 |
| InChIKey | VAVCMBBRDJPSQC-VWLOTQADSA-N |
| XLogP | 5.96 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|