C35H39NO4 — CID 57339615
(4S)-5-[4-(naphthalen-1-ylmethoxy)phenyl]-4-(7-phenylheptanoylamino)pentanoic acid (PubChem CID 57339615) has the molecular formula C35H39NO4 and a molecular weight of 537.70 g/mol. Its IUPAC name is (4S)-5-[4-(naphthalen-1-ylmethoxy)phenyl]-4-(7-phenylheptanoylamino)pentanoic acid.
| Compound Name | (4S)-5-[4-(naphthalen-1-ylmethoxy)phenyl]-4-(7-phenylheptanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 57339615 |
| Molecular Formula | C35H39NO4 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | (4S)-5-[4-(naphthalen-1-ylmethoxy)phenyl]-4-(7-phenylheptanoylamino)pentanoic acid |
| SMILES | O=C(O)CC[C@@H](Cc1ccc(OCc2cccc3ccccc23)cc1)NC(=O)CCCCCCc1ccccc1 |
| InChI | InChI=1S/C35H39NO4/c37-34(18-7-2-1-4-11-27-12-5-3-6-13-27)36-31(21-24-35(38)39)25-28-19-22-32(23-20-28)40-26-30-16-10-15-29-14-8-9-17-33(29)30/h3,5-6,8-10,12-17,19-20,22-23,31H,1-2,4,7,11,18,21,24-26H2,(H,36,37)(H,38,39)/t31-/m0/s1 |
| InChIKey | JJKPNVLZOSAPQH-HKBQPEDESA-N |
| XLogP | 7.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|