C12H16FNO4 — CID 57339713
(1S,2S,3R,4R)-5-[(4-fluorophenyl)methylamino]cyclopentane-1,2,3,4-tetrol (PubChem CID 57339713) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is (1S,2S,3R,4R)-5-[(4-fluorophenyl)methylamino]cyclopentane-1,2,3,4-tetrol.
| Compound Name | (1S,2S,3R,4R)-5-[(4-fluorophenyl)methylamino]cyclopentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 57339713 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (1S,2S,3R,4R)-5-[(4-fluorophenyl)methylamino]cyclopentane-1,2,3,4-tetrol |
| SMILES | O[C@@H]1[C@H](O)[C@H](O)C(NCc2ccc(F)cc2)[C@@H]1O |
| InChI | InChI=1S/C12H16FNO4/c13-7-3-1-6(2-4-7)5-14-8-9(15)11(17)12(18)10(8)16/h1-4,8-12,14-18H,5H2/t8?,9-,10+,11-,12+ |
| InChIKey | ZOJYEVHMPGSACR-CQGIUEJESA-N |
| XLogP | -1.26 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |