C24H31N3 — CID 57339720
(5Z)-4-ethyl-23,24,25-triazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2(25),3,5,7,9,20-heptaene (PubChem CID 57339720) has the molecular formula C24H31N3 and a molecular weight of 361.53 g/mol. Its IUPAC name is (5Z)-4-ethyl-23,24,25-triazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2(25),3,5,7,9,20-heptaene.
| Compound Name | (5Z)-4-ethyl-23,24,25-triazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2(25),3,5,7,9,20-heptaene |
|---|---|
| PubChem CID | 57339720 |
| Molecular Formula | C24H31N3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | (5Z)-4-ethyl-23,24,25-triazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2(25),3,5,7,9,20-heptaene |
| SMILES | CCC1=CC2=N/C1=C/c1ccc([nH]1)CCCCCCCCCc1ccc2[nH]1 |
| InChI | InChI=1S/C24H31N3/c1-2-18-16-24-22-15-14-20(26-22)11-9-7-5-3-4-6-8-10-19-12-13-21(25-19)17-23(18)27-24/h12-17,25-26H,2-11H2,1H3/b23-17+ |
| InChIKey | IWCZUNJQRMEDCV-HAVVHWLPSA-N |
| XLogP | 6.35 |
| TPSA | 43.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |