C30H40N2O2 — CID 57339723
(5Z,15E)-4-methoxy-30-oxa-31,32-diazatetracyclo[25.2.1.12,5.17,10]dotriaconta-1(29),2(32),3,5,7,9,15,27-octaene (PubChem CID 57339723) has the molecular formula C30H40N2O2 and a molecular weight of 460.66 g/mol. Its IUPAC name is (5Z,15E)-4-methoxy-30-oxa-31,32-diazatetracyclo[25.2.1.12,5.17,10]dotriaconta-1(29),2(32),3,5,7,9,15,27-octaene.
| Compound Name | (5Z,15E)-4-methoxy-30-oxa-31,32-diazatetracyclo[25.2.1.12,5.17,10]dotriaconta-1(29),2(32),3,5,7,9,15,27-octaene |
|---|---|
| PubChem CID | 57339723 |
| Molecular Formula | C30H40N2O2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | (5Z,15E)-4-methoxy-30-oxa-31,32-diazatetracyclo[25.2.1.12,5.17,10]dotriaconta-1(29),2(32),3,5,7,9,15,27-octaene |
| SMILES | COC1=CC2=N/C1=C/c1ccc([nH]1)CCCC/C=C/CCCCCCCCCCc1ccc2o1 |
| InChI | InChI=1S/C30H40N2O2/c1-33-30-23-28-29-21-20-26(34-29)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-24-18-19-25(31-24)22-27(30)32-28/h6,8,18-23,31H,2-5,7,9-17H2,1H3/b8-6+,27-22+ |
| InChIKey | OZJXRAIKMOIUFA-UYVPSTCYSA-N |
| XLogP | 8.32 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|