About 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole (PubChem CID 57339816) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole.
Molecular Properties
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole |
| PubChem CID | 57339816 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole |
| SMILES | CC(C)=CCC/C(C)=C/Cc1ncc[nH]1 |
| InChI | InChI=1S/C13H20N2/c1-11(2)5-4-6-12(3)7-8-13-14-9-10-15-13/h5,7,9-10H,4,6,8H2,1-3H3,(H,14,15)/b12-7+ |
| InChIKey | ILOXEPYJYBNBIU-KPKJPENVSA-N |
| XLogP | 3.64 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole?
The IUPAC name of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole (CID 57339816) is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole.
What is the SMILES notation for 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole?
The canonical SMILES for 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole is CC(C)=CCC/C(C)=C/Cc1ncc[nH]1.
What is the InChIKey of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole?
The InChIKey is ILOXEPYJYBNBIU-KPKJPENVSA-N. The full InChI is InChI=1S/C13H20N2/c1-11(2)5-4-6-12(3)7-8-13-14-9-10-15-13/h5,7,9-10H,4,6,8H2,1-3H3,(H,14,15)/b12-7+.
What are the key properties of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole?
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole has a molecular weight of 204.32 g/mol, XLogP of 3.64, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1H-imidazole is sourced from PubChem (CID 57339816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).