About 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol
5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol (PubChem CID 57340002) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol |
| PubChem CID | 57340002 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol |
| SMILES | CCCC1(CCC)NCC(O)C(O)C1CO |
| InChI | InChI=1S/C12H25NO3/c1-3-5-12(6-4-2)9(8-14)11(16)10(15)7-13-12/h9-11,13-16H,3-8H2,1-2H3 |
| InChIKey | GZJQITPDATVFSD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol?
The IUPAC name of 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol (CID 57340002) is 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol.
What is the SMILES notation for 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol?
The canonical SMILES for 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol is CCCC1(CCC)NCC(O)C(O)C1CO.
What is the InChIKey of 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol?
The InChIKey is GZJQITPDATVFSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-3-5-12(6-4-2)9(8-14)11(16)10(15)7-13-12/h9-11,13-16H,3-8H2,1-2H3.
What are the key properties of 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol?
5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol has a molecular weight of 231.34 g/mol, XLogP of 0.26, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-6,6-dipropylpiperidine-3,4-diol is sourced from PubChem (CID 57340002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).