About 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol
5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol (PubChem CID 57340003) has the molecular formula C9H19NO4
and a molecular weight of 205.25 g/mol. Its IUPAC name is 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol |
| PubChem CID | 57340003 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol |
| SMILES | OCCCC1NCC(O)C(O)C1CO |
| InChI | InChI=1S/C9H19NO4/c11-3-1-2-7-6(5-12)9(14)8(13)4-10-7/h6-14H,1-5H2 |
| InChIKey | ONRQATVXGSHIBI-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol?
The IUPAC name of 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol (CID 57340003) is 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol.
What is the SMILES notation for 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol?
The canonical SMILES for 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol is OCCCC1NCC(O)C(O)C1CO.
What is the InChIKey of 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol?
The InChIKey is ONRQATVXGSHIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO4/c11-3-1-2-7-6(5-12)9(14)8(13)4-10-7/h6-14H,1-5H2.
What are the key properties of 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol?
5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol has a molecular weight of 205.25 g/mol, XLogP of -1.94, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-6-(3-hydroxypropyl)piperidine-3,4-diol is sourced from PubChem (CID 57340003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).