About 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole
2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole (PubChem CID 57340178) has the molecular formula C16H15N3O4S3
and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole |
| PubChem CID | 57340178 |
| Molecular Formula | C16H15N3O4S3 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole |
| SMILES | NS(=O)(=O)NCc1csc(-c2ccc(S(=O)(=O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C16H15N3O4S3/c17-26(22,23)18-10-13-11-24-16(19-13)12-6-8-15(9-7-12)25(20,21)14-4-2-1-3-5-14/h1-9,11,18H,10H2,(H2,17,22,23) |
| InChIKey | ZBCYYPLZTWIDDF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole?
The IUPAC name of 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole (CID 57340178) is 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole.
What is the SMILES notation for 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole?
The canonical SMILES for 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole is NS(=O)(=O)NCc1csc(-c2ccc(S(=O)(=O)c3ccccc3)cc2)n1.
What is the InChIKey of 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole?
The InChIKey is ZBCYYPLZTWIDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O4S3/c17-26(22,23)18-10-13-11-24-16(19-13)12-6-8-15(9-7-12)25(20,21)14-4-2-1-3-5-14/h1-9,11,18H,10H2,(H2,17,22,23).
What are the key properties of 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole?
2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole has a molecular weight of 409.51 g/mol, XLogP of 1.94, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(benzenesulfonyl)phenyl]-4-[(sulfamoylamino)methyl]-1,3-thiazole is sourced from PubChem (CID 57340178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).