About [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate
[2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate (PubChem CID 57340182) has the molecular formula C16H13ClN2O5S3
and a molecular weight of 444.94 g/mol. Its IUPAC name is [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate.
Molecular Properties
| Compound Name | [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate |
| PubChem CID | 57340182 |
| Molecular Formula | C16H13ClN2O5S3 |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 443.97 |
| IUPAC Name | [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OCc1csc(-c2ccc(S(=O)(=O)c3ccc(Cl)cc3)cc2)n1 |
| InChI | InChI=1S/C16H13ClN2O5S3/c17-12-3-7-15(8-4-12)26(20,21)14-5-1-11(2-6-14)16-19-13(10-25-16)9-24-27(18,22)23/h1-8,10H,9H2,(H2,18,22,23) |
| InChIKey | LXOHIMDOJADTLR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate?
The IUPAC name of [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate (CID 57340182) is [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate.
What is the SMILES notation for [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate?
The canonical SMILES for [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate is NS(=O)(=O)OCc1csc(-c2ccc(S(=O)(=O)c3ccc(Cl)cc3)cc2)n1.
What is the InChIKey of [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate?
The InChIKey is LXOHIMDOJADTLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN2O5S3/c17-12-3-7-15(8-4-12)26(20,21)14-5-1-11(2-6-14)16-19-13(10-25-16)9-24-27(18,22)23/h1-8,10H,9H2,(H2,18,22,23).
What are the key properties of [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate?
[2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate has a molecular weight of 444.94 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(4-chlorophenyl)sulfonylphenyl]-1,3-thiazol-4-yl]methyl sulfamate is sourced from PubChem (CID 57340182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).