About amino 6-ethoxy-1,3-benzothiazole-2-carboxylate
amino 6-ethoxy-1,3-benzothiazole-2-carboxylate (PubChem CID 57340226) has the molecular formula C10H10N2O3S
and a molecular weight of 238.27 g/mol. Its IUPAC name is amino 6-ethoxy-1,3-benzothiazole-2-carboxylate.
Molecular Properties
| Compound Name | amino 6-ethoxy-1,3-benzothiazole-2-carboxylate |
| PubChem CID | 57340226 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | amino 6-ethoxy-1,3-benzothiazole-2-carboxylate |
| SMILES | CCOc1ccc2nc(C(=O)ON)sc2c1 |
| InChI | InChI=1S/C10H10N2O3S/c1-2-14-6-3-4-7-8(5-6)16-9(12-7)10(13)15-11/h3-5H,2,11H2,1H3 |
| InChIKey | KYEDSYGQLUWFDF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 6-ethoxy-1,3-benzothiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 6-ethoxy-1,3-benzothiazole-2-carboxylate?
The IUPAC name of amino 6-ethoxy-1,3-benzothiazole-2-carboxylate (CID 57340226) is amino 6-ethoxy-1,3-benzothiazole-2-carboxylate.
What is the SMILES notation for amino 6-ethoxy-1,3-benzothiazole-2-carboxylate?
The canonical SMILES for amino 6-ethoxy-1,3-benzothiazole-2-carboxylate is CCOc1ccc2nc(C(=O)ON)sc2c1.
What is the InChIKey of amino 6-ethoxy-1,3-benzothiazole-2-carboxylate?
The InChIKey is KYEDSYGQLUWFDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3S/c1-2-14-6-3-4-7-8(5-6)16-9(12-7)10(13)15-11/h3-5H,2,11H2,1H3.
What are the key properties of amino 6-ethoxy-1,3-benzothiazole-2-carboxylate?
amino 6-ethoxy-1,3-benzothiazole-2-carboxylate has a molecular weight of 238.27 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for amino 6-ethoxy-1,3-benzothiazole-2-carboxylate is sourced from PubChem (CID 57340226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).