C16H28O7 — CID 57340434
p-menth-3-ene-1,2-diol 1-O-B-glucopyranoside, 5 (PubChem CID 57340434) has the molecular formula C16H28O7 and a molecular weight of 332.39 g/mol. Its IUPAC name is (3S,4S,6S)-2-(hydroxymethyl)-6-[(1S,2S)-2-hydroxy-1-methyl-4-propan-2-ylcyclohex-3-en-1-yl]oxyoxane-3,4,5-triol.
| Compound Name | p-menth-3-ene-1,2-diol 1-O-B-glucopyranoside, 5 |
|---|---|
| PubChem CID | 57340434 |
| Molecular Formula | C16H28O7 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (3S,4S,6S)-2-(hydroxymethyl)-6-[(1S,2S)-2-hydroxy-1-methyl-4-propan-2-ylcyclohex-3-en-1-yl]oxyoxane-3,4,5-triol |
| SMILES | CC(C)C1=C[C@@H]([C@@](CC1)(C)O[C@H]2C([C@H]([C@@H](C(O2)CO)O)O)O)O |
| InChI | InChI=1S/C16H28O7/c1-8(2)9-4-5-16(3,11(18)6-9)23-15-14(21)13(20)12(19)10(7-17)22-15/h6,8,10-15,17-21H,4-5,7H2,1-3H3/t10?,11-,12+,13-,14?,15-,16-/m0/s1 |
| InChIKey | HDVPJYNBUXNSEW-QWXDJCMXSA-N |
| XLogP | -0.70 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 438 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|