C31H33BrO4 — CID 57340449
2-[[4-[(Z)-1-bromo-2-phenylethenyl]phenyl]-(4,4-dimethyl-2,6-dioxocyclohexyl)methyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 57340449) has the molecular formula C31H33BrO4 and a molecular weight of 549.51 g/mol. Its IUPAC name is 2-[[4-[(Z)-1-bromo-2-phenylethenyl]phenyl]-(4,4-dimethyl-2,6-dioxocyclohexyl)methyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[[4-[(Z)-1-bromo-2-phenylethenyl]phenyl]-(4,4-dimethyl-2,6-dioxocyclohexyl)methyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 57340449 |
| Molecular Formula | C31H33BrO4 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 2-[[4-[(Z)-1-bromo-2-phenylethenyl]phenyl]-(4,4-dimethyl-2,6-dioxocyclohexyl)methyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C(c2ccc(/C(Br)=C/c3ccccc3)cc2)C2C(=O)CC(C)(C)CC2=O)C(=O)C1 |
| InChI | InChI=1S/C31H33BrO4/c1-30(2)15-23(33)28(24(34)16-30)27(29-25(35)17-31(3,4)18-26(29)36)21-12-10-20(11-13-21)22(32)14-19-8-6-5-7-9-19/h5-14,27-29H,15-18H2,1-4H3/b22-14- |
| InChIKey | WWWCQVXPDKJHPI-HMAPJEAMSA-N |
| XLogP | 6.81 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|