C21H32O9 — CID 57340452
[(3S,3aR,7S,7aS)-3-hydroxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3a,6,7,7a-tetrahydro-3H-inden-1-yl]methyl 3-methylbutanoate (PubChem CID 57340452) has the molecular formula C21H32O9 and a molecular weight of 428.48 g/mol. Its IUPAC name is [(3S,3aR,7S,7aS)-3-hydroxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3a,6,7,7a-tetrahydro-3H-inden-1-yl]methyl 3-methylbutanoate.
| Compound Name | [(3S,3aR,7S,7aS)-3-hydroxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3a,6,7,7a-tetrahydro-3H-inden-1-yl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 57340452 |
| Molecular Formula | C21H32O9 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | [(3S,3aR,7S,7aS)-3-hydroxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3a,6,7,7a-tetrahydro-3H-inden-1-yl]methyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCC1=C[C@@H](O)[C@@H]2C=CC[C@H](OC3OC(CO)C(O)C(O)C3O)[C@H]12 |
| InChI | InChI=1S/C21H32O9/c1-10(2)6-16(24)28-9-11-7-13(23)12-4-3-5-14(17(11)12)29-21-20(27)19(26)18(25)15(8-22)30-21/h3-4,7,10,12-15,17-23,25-27H,5-6,8-9H2,1-2H3/t12-,13+,14-,15?,17+,18?,19?,20?,21?/m0/s1 |
| InChIKey | BOQHTPKASCLYLL-KALJSCEQSA-N |
| XLogP | -0.75 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|