C26H30N4O7S2 — CID 57340473
2-[[4-[2-[[3-oxo-3-[(2-propylsulfanyl-1,3-benzothiazol-6-yl)amino]propyl]carbamoylamino]ethoxy]phenyl]methyl]propanedioic acid (PubChem CID 57340473) has the molecular formula C26H30N4O7S2 and a molecular weight of 574.68 g/mol. Its IUPAC name is 2-[[4-[2-[[3-oxo-3-[(2-propylsulfanyl-1,3-benzothiazol-6-yl)amino]propyl]carbamoylamino]ethoxy]phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[4-[2-[[3-oxo-3-[(2-propylsulfanyl-1,3-benzothiazol-6-yl)amino]propyl]carbamoylamino]ethoxy]phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 57340473 |
| Molecular Formula | C26H30N4O7S2 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 2-[[4-[2-[[3-oxo-3-[(2-propylsulfanyl-1,3-benzothiazol-6-yl)amino]propyl]carbamoylamino]ethoxy]phenyl]methyl]propanedioic acid |
| SMILES | CCCSc1nc2ccc(NC(=O)CCNC(=O)NCCOc3ccc(CC(C(=O)O)C(=O)O)cc3)cc2s1 |
| InChI | InChI=1S/C26H30N4O7S2/c1-2-13-38-26-30-20-8-5-17(15-21(20)39-26)29-22(31)9-10-27-25(36)28-11-12-37-18-6-3-16(4-7-18)14-19(23(32)33)24(34)35/h3-8,15,19H,2,9-14H2,1H3,(H,29,31)(H,32,33)(H,34,35)(H2,27,28,36) |
| InChIKey | ULZFONRJONTZBF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 166.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|