C19H24N5O+ — CID 57340843
3-[[1-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methoxy]benzonitrile (PubChem CID 57340843) has the molecular formula C19H24N5O+ and a molecular weight of 338.44 g/mol. Its IUPAC name is 3-[[1-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methoxy]benzonitrile.
| Compound Name | 3-[[1-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 57340843 |
| Molecular Formula | C19H24N5O+ |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-[[1-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methoxy]benzonitrile |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(n1cc(COc3cccc(C#N)c3)nn1)C2 |
| InChI | InChI=1S/C19H24N5O/c1-24(2)17-6-7-18(24)10-16(9-17)23-12-15(21-22-23)13-25-19-5-3-4-14(8-19)11-20/h3-5,8,12,16-18H,6-7,9-10,13H2,1-2H3/q+1/t16?,17-,18+ |
| InChIKey | CKMPEOXRXCLLTD-AYHJJNSGSA-N |
| XLogP | 2.67 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|