C17H24N5O2+ — CID 57340851
N-[[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methyl]furan-2-carboxamide (PubChem CID 57340851) has the molecular formula C17H24N5O2+ and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 57340851 |
| Molecular Formula | C17H24N5O2+ |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methyl]furan-2-carboxamide |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(n1cc(CNC(=O)c3ccco3)nn1)C2 |
| InChI | InChI=1S/C17H23N5O2/c1-22(2)14-5-6-15(22)9-13(8-14)21-11-12(19-20-21)10-18-17(23)16-4-3-7-24-16/h3-4,7,11,13-15H,5-6,8-10H2,1-2H3/p+1/t13?,14-,15+ |
| InChIKey | CGLAHZYIMVZESD-GOOCMWNKSA-O |
| XLogP | 1.74 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|