C19H24N5S2+ — CID 57340857
2-[[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methylsulfanyl]-1,3-benzothiazole (PubChem CID 57340857) has the molecular formula C19H24N5S2+ and a molecular weight of 386.57 g/mol. Its IUPAC name is 2-[[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methylsulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 57340857 |
| Molecular Formula | C19H24N5S2+ |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]methylsulfanyl]-1,3-benzothiazole |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(n1cc(CSc3nc4ccccc4s3)nn1)C2 |
| InChI | InChI=1S/C19H24N5S2/c1-24(2)15-7-8-16(24)10-14(9-15)23-11-13(21-22-23)12-25-19-20-17-5-3-4-6-18(17)26-19/h3-6,11,14-16H,7-10,12H2,1-2H3/q+1/t14?,15-,16+ |
| InChIKey | IBNOEZXSEAOZFI-MQVJKMGUSA-N |
| XLogP | 4.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|