C23H33N4O+ — CID 57340863
(1R,5S)-3-[4-[(2-cyclopentylphenoxy)methyl]triazol-1-yl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane (PubChem CID 57340863) has the molecular formula C23H33N4O+ and a molecular weight of 381.54 g/mol. Its IUPAC name is (1R,5S)-3-[4-[(2-cyclopentylphenoxy)methyl]triazol-1-yl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-3-[4-[(2-cyclopentylphenoxy)methyl]triazol-1-yl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 57340863 |
| Molecular Formula | C23H33N4O+ |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | (1R,5S)-3-[4-[(2-cyclopentylphenoxy)methyl]triazol-1-yl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(n1cc(COc3ccccc3C3CCCC3)nn1)C2 |
| InChI | InChI=1S/C23H33N4O/c1-27(2)20-11-12-21(27)14-19(13-20)26-15-18(24-25-26)16-28-23-10-6-5-9-22(23)17-7-3-4-8-17/h5-6,9-10,15,17,19-21H,3-4,7-8,11-14,16H2,1-2H3/q+1/t19?,20-,21+ |
| InChIKey | DRNDBVNYXSIPQB-SEJPIABJSA-N |
| XLogP | 4.46 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|