C19H24F3N4O+ — CID 57340865
1-[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]-2,2,2-trifluoro-1-phenylethanol (PubChem CID 57340865) has the molecular formula C19H24F3N4O+ and a molecular weight of 381.42 g/mol. Its IUPAC name is 1-[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]-2,2,2-trifluoro-1-phenylethanol.
| Compound Name | 1-[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]-2,2,2-trifluoro-1-phenylethanol |
|---|---|
| PubChem CID | 57340865 |
| Molecular Formula | C19H24F3N4O+ |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-[1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]triazol-4-yl]-2,2,2-trifluoro-1-phenylethanol |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(n1cc(C(O)(c3ccccc3)C(F)(F)F)nn1)C2 |
| InChI | InChI=1S/C19H24F3N4O/c1-26(2)15-8-9-16(26)11-14(10-15)25-12-17(23-24-25)18(27,19(20,21)22)13-6-4-3-5-7-13/h3-7,12,14-16,27H,8-11H2,1-2H3/q+1/t14?,15-,16+,18? |
| InChIKey | PWKKSSBTEGAJJS-BHBVFMNGSA-N |
| XLogP | 3.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|