C7H13NO3 — CID 57341107
(2R,3S,4S,5R)-2-ethenylpiperidine-3,4,5-triol (PubChem CID 57341107) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-ethenylpiperidine-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-ethenylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 57341107 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (2R,3S,4S,5R)-2-ethenylpiperidine-3,4,5-triol |
| SMILES | C=C[C@H]1NC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H13NO3/c1-2-4-6(10)7(11)5(9)3-8-4/h2,4-11H,1,3H2/t4-,5-,6+,7+/m1/s1 |
| InChIKey | XUWJGWVDBHLQOD-JWXFUTCRSA-N |
| XLogP | -1.77 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|