C7H16ClNO3 — CID 57341108
(2R,3S,4S,5R)-2-ethylpiperidine-3,4,5-triol;hydrochloride (PubChem CID 57341108) has the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-ethylpiperidine-3,4,5-triol;hydrochloride.
| Compound Name | (2R,3S,4S,5R)-2-ethylpiperidine-3,4,5-triol;hydrochloride |
|---|---|
| PubChem CID | 57341108 |
| Molecular Formula | C7H16ClNO3 |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (2R,3S,4S,5R)-2-ethylpiperidine-3,4,5-triol;hydrochloride |
| SMILES | CC[C@H]1NC[C@@H](O)[C@H](O)[C@H]1O.Cl |
| InChI | InChI=1S/C7H15NO3.ClH/c1-2-4-6(10)7(11)5(9)3-8-4;/h4-11H,2-3H2,1H3;1H/t4-,5-,6+,7+;/m1./s1 |
| InChIKey | SLMXBMZUPDXISI-MWOFTINQSA-N |
| XLogP | -1.13 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |