About 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid
4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid (PubChem CID 57341126) has the molecular formula C9H15N2O5P
and a molecular weight of 262.20 g/mol. Its IUPAC name is 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid.
Molecular Properties
| Compound Name | 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid |
| PubChem CID | 57341126 |
| Molecular Formula | C9H15N2O5P |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid |
| SMILES | Cc1cn(CCCCP(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H15N2O5P/c1-7-6-11(9(13)10-8(7)12)4-2-3-5-17(14,15)16/h6H,2-5H2,1H3,(H,10,12,13)(H2,14,15,16) |
| InChIKey | FGQNFHLFURFTTJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid?
The IUPAC name of 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid (CID 57341126) is 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid.
What is the SMILES notation for 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid?
The canonical SMILES for 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid is Cc1cn(CCCCP(=O)(O)O)c(=O)[nH]c1=O.
What is the InChIKey of 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid?
The InChIKey is FGQNFHLFURFTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N2O5P/c1-7-6-11(9(13)10-8(7)12)4-2-3-5-17(14,15)16/h6H,2-5H2,1H3,(H,10,12,13)(H2,14,15,16).
What are the key properties of 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid?
4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid has a molecular weight of 262.20 g/mol, XLogP of -0.20, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylphosphonic acid is sourced from PubChem (CID 57341126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).