C24H34N4O3S — CID 57341140
tert-butyl N-[3-[6-[[amino(thiophen-2-yl)methylidene]amino]-3,4-dihydro-2H-quinolin-1-yl]propyl]-N-(2-hydroxyethyl)carbamate (PubChem CID 57341140) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is tert-butyl N-[3-[6-[[amino(thiophen-2-yl)methylidene]amino]-3,4-dihydro-2H-quinolin-1-yl]propyl]-N-(2-hydroxyethyl)carbamate.
| Compound Name | tert-butyl N-[3-[6-[[amino(thiophen-2-yl)methylidene]amino]-3,4-dihydro-2H-quinolin-1-yl]propyl]-N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 57341140 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | tert-butyl N-[3-[6-[[amino(thiophen-2-yl)methylidene]amino]-3,4-dihydro-2H-quinolin-1-yl]propyl]-N-(2-hydroxyethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCO)CCCN1CCCc2cc(/N=C(\N)c3cccs3)ccc21 |
| InChI | InChI=1S/C24H34N4O3S/c1-24(2,3)31-23(30)28(14-15-29)13-6-12-27-11-4-7-18-17-19(9-10-20(18)27)26-22(25)21-8-5-16-32-21/h5,8-10,16-17,29H,4,6-7,11-15H2,1-3H3,(H2,25,26) |
| InChIKey | AJHKSOQTDWEULO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|