C28H32N8O2 — CID 57341298
N-[3-[3-methyl-7-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]phenyl]prop-2-enamide (PubChem CID 57341298) has the molecular formula C28H32N8O2 and a molecular weight of 512.62 g/mol. Its IUPAC name is N-[3-[3-methyl-7-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[3-methyl-7-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 57341298 |
| Molecular Formula | C28H32N8O2 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | N-[3-[3-methyl-7-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(N2C(=O)N(C)Cc3cnc(Nc4ccc(N5CCN(C)CC5)cc4C)nc32)c1 |
| InChI | InChI=1S/C28H32N8O2/c1-5-25(37)30-21-7-6-8-23(16-21)36-26-20(18-34(4)28(36)38)17-29-27(32-26)31-24-10-9-22(15-19(24)2)35-13-11-33(3)12-14-35/h5-10,15-17H,1,11-14,18H2,2-4H3,(H,30,37)(H,29,31,32) |
| InChIKey | ZZGGOXMEIWLVTJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|