C14H22ClNO3S — CID 57341306
(2R,3S,4S,5R)-2-(2-benzylsulfanylethyl)piperidine-3,4,5-triol;hydrochloride (PubChem CID 57341306) has the molecular formula C14H22ClNO3S and a molecular weight of 319.85 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(2-benzylsulfanylethyl)piperidine-3,4,5-triol;hydrochloride.
| Compound Name | (2R,3S,4S,5R)-2-(2-benzylsulfanylethyl)piperidine-3,4,5-triol;hydrochloride |
|---|---|
| PubChem CID | 57341306 |
| Molecular Formula | C14H22ClNO3S |
| Molecular Weight | 319.85 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2R,3S,4S,5R)-2-(2-benzylsulfanylethyl)piperidine-3,4,5-triol;hydrochloride |
| SMILES | Cl.O[C@@H]1[C@@H](O)[C@@H](CCSCc2ccccc2)NC[C@H]1O |
| InChI | InChI=1S/C14H21NO3S.ClH/c16-12-8-15-11(13(17)14(12)18)6-7-19-9-10-4-2-1-3-5-10;/h1-5,11-18H,6-9H2;1H/t11-,12-,13+,14+;/m1./s1 |
| InChIKey | WSRBYQNRNPRRBX-JQGWAELESA-N |
| XLogP | 0.79 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.85 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|